About N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide
N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide (PubChem CID 2231787) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide.
Molecular Properties
| Compound Name | N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide |
| PubChem CID | 2231787 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1ccc2nc(C)c(C)nc2c1 |
| InChI | InChI=1S/C18H17N3O2/c1-11-12(2)20-16-10-13(8-9-14(16)19-11)18(22)21-15-6-4-5-7-17(15)23-3/h4-10H,1-3H3,(H,21,22) |
| InChIKey | WBBVGSPUKZPBBI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide?
The IUPAC name of N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide (CID 2231787) is N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide.
What is the SMILES notation for N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide?
The canonical SMILES for N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide is COc1ccccc1NC(=O)c1ccc2nc(C)c(C)nc2c1.
What is the InChIKey of N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide?
The InChIKey is WBBVGSPUKZPBBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-11-12(2)20-16-10-13(8-9-14(16)19-11)18(22)21-15-6-4-5-7-17(15)23-3/h4-10H,1-3H3,(H,21,22).
What are the key properties of N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide?
N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide has a molecular weight of 307.35 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyphenyl)-2,3-dimethylquinoxaline-6-carboxamide is sourced from PubChem (CID 2231787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).