About 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole
1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole (PubChem CID 2231812) has the molecular formula C21H26N2O2
and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole |
| PubChem CID | 2231812 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole |
| SMILES | CCCCOc1ccccc1OCCn1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C21H26N2O2/c1-4-5-11-24-20-8-6-7-9-21(20)25-12-10-23-15-22-18-13-16(2)17(3)14-19(18)23/h6-9,13-15H,4-5,10-12H2,1-3H3 |
| InChIKey | APONLIMMFMPYKF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole?
The IUPAC name of 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole (CID 2231812) is 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole.
What is the SMILES notation for 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole?
The canonical SMILES for 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole is CCCCOc1ccccc1OCCn1cnc2cc(C)c(C)cc21.
What is the InChIKey of 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole?
The InChIKey is APONLIMMFMPYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O2/c1-4-5-11-24-20-8-6-7-9-21(20)25-12-10-23-15-22-18-13-16(2)17(3)14-19(18)23/h6-9,13-15H,4-5,10-12H2,1-3H3.
What are the key properties of 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole?
1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole has a molecular weight of 338.45 g/mol, XLogP of 4.91, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-butoxyphenoxy)ethyl]-5,6-dimethylbenzimidazole is sourced from PubChem (CID 2231812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).