C18H15Cl2N7O4 — CID 22318513
1-N-[2-[[6-(2,4-dichlorophenyl)-5-nitropyrazin-2-yl]amino]ethyl]-4-nitrobenzene-1,3-diamine (PubChem CID 22318513) has the molecular formula C18H15Cl2N7O4 and a molecular weight of 464.27 g/mol. Its IUPAC name is 1-N-[2-[[6-(2,4-dichlorophenyl)-5-nitropyrazin-2-yl]amino]ethyl]-4-nitrobenzene-1,3-diamine.
| Compound Name | 1-N-[2-[[6-(2,4-dichlorophenyl)-5-nitropyrazin-2-yl]amino]ethyl]-4-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 22318513 |
| Molecular Formula | C18H15Cl2N7O4 |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 1-N-[2-[[6-(2,4-dichlorophenyl)-5-nitropyrazin-2-yl]amino]ethyl]-4-nitrobenzene-1,3-diamine |
| SMILES | Nc1cc(NCCNc2cnc([N+](=O)[O-])c(-c3ccc(Cl)cc3Cl)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15Cl2N7O4/c19-10-1-3-12(13(20)7-10)17-18(27(30)31)24-9-16(25-17)23-6-5-22-11-2-4-15(26(28)29)14(21)8-11/h1-4,7-9,22H,5-6,21H2,(H,23,25) |
| InChIKey | MYQRNPJWROYIGH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|