C11H11N3O2 — CID 22318764
7-methyl-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene-12-carboxylic acid (PubChem CID 22318764) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 7-methyl-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene-12-carboxylic acid.
| Compound Name | 7-methyl-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene-12-carboxylic acid |
|---|---|
| PubChem CID | 22318764 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 7-methyl-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene-12-carboxylic acid |
| SMILES | CC1Cc2[nH]cc(C(=O)O)c2-c2nccn21 |
| InChI | InChI=1S/C11H11N3O2/c1-6-4-8-9(7(5-13-8)11(15)16)10-12-2-3-14(6)10/h2-3,5-6,13H,4H2,1H3,(H,15,16) |
| InChIKey | DYPCZFLHZOQBHU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |