C9H12N2 — CID 22319466
7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 22319466) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 22319466 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 7-methyl-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | Cc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C9H12N2/c1-7-4-5-8-3-2-6-10-9(8)11-7/h4-5H,2-3,6H2,1H3,(H,10,11) |
| InChIKey | HBWCJMBLUCNJIS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |