About N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide
N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 2231948) has the molecular formula C21H15N3O2
and a molecular weight of 341.37 g/mol. Its IUPAC name is N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide |
| PubChem CID | 2231948 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(-c2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C21H15N3O2/c25-19(22-18-12-5-2-6-13-18)16-10-7-11-17(14-16)21-24-23-20(26-21)15-8-3-1-4-9-15/h1-14H,(H,22,25) |
| InChIKey | RIHOYVMBUVLYNC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide?
The IUPAC name of N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide (CID 2231948) is N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide.
What is the SMILES notation for N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide?
The canonical SMILES for N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide is O=C(Nc1ccccc1)c1cccc(-c2nnc(-c3ccccc3)o2)c1.
What is the InChIKey of N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide?
The InChIKey is RIHOYVMBUVLYNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N3O2/c25-19(22-18-12-5-2-6-13-18)16-10-7-11-17(14-16)21-24-23-20(26-21)15-8-3-1-4-9-15/h1-14H,(H,22,25).
What are the key properties of N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide?
N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide has a molecular weight of 341.37 g/mol, XLogP of 4.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide is sourced from PubChem (CID 2231948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).