About 5-bromo-2,2-diphenyl-1,3-benzodioxole
5-bromo-2,2-diphenyl-1,3-benzodioxole (PubChem CID 22319515) has the molecular formula C19H13BrO2
and a molecular weight of 353.22 g/mol. Its IUPAC name is 5-bromo-2,2-diphenyl-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-bromo-2,2-diphenyl-1,3-benzodioxole |
| PubChem CID | 22319515 |
| Molecular Formula | C19H13BrO2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 5-bromo-2,2-diphenyl-1,3-benzodioxole |
| SMILES | Brc1ccc2c(c1)OC(c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C19H13BrO2/c20-16-11-12-17-18(13-16)22-19(21-17,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H |
| InChIKey | DZPGCBNJLAKMQJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2,2-diphenyl-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,2-diphenyl-1,3-benzodioxole?
The IUPAC name of 5-bromo-2,2-diphenyl-1,3-benzodioxole (CID 22319515) is 5-bromo-2,2-diphenyl-1,3-benzodioxole.
What is the SMILES notation for 5-bromo-2,2-diphenyl-1,3-benzodioxole?
The canonical SMILES for 5-bromo-2,2-diphenyl-1,3-benzodioxole is Brc1ccc2c(c1)OC(c1ccccc1)(c1ccccc1)O2.
What is the InChIKey of 5-bromo-2,2-diphenyl-1,3-benzodioxole?
The InChIKey is DZPGCBNJLAKMQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BrO2/c20-16-11-12-17-18(13-16)22-19(21-17,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H.
What are the key properties of 5-bromo-2,2-diphenyl-1,3-benzodioxole?
5-bromo-2,2-diphenyl-1,3-benzodioxole has a molecular weight of 353.22 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,2-diphenyl-1,3-benzodioxole is sourced from PubChem (CID 22319515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).