C23H37BClN3O4Si — CID 22319527
N-[6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide (PubChem CID 22319527) has the molecular formula C23H37BClN3O4Si and a molecular weight of 493.92 g/mol. Its IUPAC name is N-[6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide.
| Compound Name | N-[6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide |
|---|---|
| PubChem CID | 22319527 |
| Molecular Formula | C23H37BClN3O4Si |
| Molecular Weight | 493.92 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | N-[6-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide |
| SMILES | CCCC(=O)Nc1nn(COCC[Si](C)(C)C)c2cc(Cl)c(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C23H37BClN3O4Si/c1-9-10-20(29)26-21-16-13-17(24-31-22(2,3)23(4,5)32-24)18(25)14-19(16)28(27-21)15-30-11-12-33(6,7)8/h13-14H,9-12,15H2,1-8H3,(H,26,27,29) |
| InChIKey | WTFNYWIAMPVEMK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.92 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|