About N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide
N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide (PubChem CID 22319609) has the molecular formula C17H15F2N3O
and a molecular weight of 315.32 g/mol. Its IUPAC name is N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide.
Molecular Properties
| Compound Name | N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide |
| PubChem CID | 22319609 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide |
| SMILES | CCCC(=O)Nc1n[nH]c2c(F)c(F)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C17H15F2N3O/c1-2-6-13(23)20-17-12-9-11(10-7-4-3-5-8-10)14(18)15(19)16(12)21-22-17/h3-5,7-9H,2,6H2,1H3,(H2,20,21,22,23) |
| InChIKey | TZFLUWBMBJLZQO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide?
The IUPAC name of N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide (CID 22319609) is N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide.
What is the SMILES notation for N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide?
The canonical SMILES for N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide is CCCC(=O)Nc1n[nH]c2c(F)c(F)c(-c3ccccc3)cc12.
What is the InChIKey of N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide?
The InChIKey is TZFLUWBMBJLZQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N3O/c1-2-6-13(23)20-17-12-9-11(10-7-4-3-5-8-10)14(18)15(19)16(12)21-22-17/h3-5,7-9H,2,6H2,1H3,(H2,20,21,22,23).
What are the key properties of N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide?
N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide has a molecular weight of 315.32 g/mol, XLogP of 4.25, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)butanamide is sourced from PubChem (CID 22319609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).