About N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide
N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide (PubChem CID 22319657) has the molecular formula C11H10BrF2N3O
and a molecular weight of 318.12 g/mol. Its IUPAC name is N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide.
Molecular Properties
| Compound Name | N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide |
| PubChem CID | 22319657 |
| Molecular Formula | C11H10BrF2N3O |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide |
| SMILES | CCCC(=O)Nc1n[nH]c2c(F)c(F)c(Br)cc12 |
| InChI | InChI=1S/C11H10BrF2N3O/c1-2-3-7(18)15-11-5-4-6(12)8(13)9(14)10(5)16-17-11/h4H,2-3H2,1H3,(H2,15,16,17,18) |
| InChIKey | PXLBOIVAUGMGET-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide?
The IUPAC name of N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide (CID 22319657) is N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide.
What is the SMILES notation for N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide?
The canonical SMILES for N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide is CCCC(=O)Nc1n[nH]c2c(F)c(F)c(Br)cc12.
What is the InChIKey of N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide?
The InChIKey is PXLBOIVAUGMGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrF2N3O/c1-2-3-7(18)15-11-5-4-6(12)8(13)9(14)10(5)16-17-11/h4H,2-3H2,1H3,(H2,15,16,17,18).
What are the key properties of N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide?
N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide has a molecular weight of 318.12 g/mol, XLogP of 3.34, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-6,7-difluoro-1H-indazol-3-yl)butanamide is sourced from PubChem (CID 22319657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).