C16H25NO3 — CID 2232033
(2R)-1-[2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethoxy]ethylamino]propan-2-ol (PubChem CID 2232033) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (2R)-1-[2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethoxy]ethylamino]propan-2-ol.
| Compound Name | (2R)-1-[2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethoxy]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 2232033 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (2R)-1-[2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethoxy]ethylamino]propan-2-ol |
| SMILES | C[C@@H](O)CNCCOCCOc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H25NO3/c1-13(18)12-17-7-8-19-9-10-20-16-6-5-14-3-2-4-15(14)11-16/h5-6,11,13,17-18H,2-4,7-10,12H2,1H3/t13-/m1/s1 |
| InChIKey | RIKBNNLIWJTPSS-CYBMUJFWSA-N |
| XLogP | 1.54 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|