C17H26N4O2S — CID 22320424
2-methyl-1-(5-methylsulfonylpentyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-4-amine (PubChem CID 22320424) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-methyl-1-(5-methylsulfonylpentyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-methyl-1-(5-methylsulfonylpentyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 22320424 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-methyl-1-(5-methylsulfonylpentyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-4-amine |
| SMILES | Cc1nc2c(N)nc3c(c2n1CCCCCS(C)(=O)=O)CCCC3 |
| InChI | InChI=1S/C17H26N4O2S/c1-12-19-15-16(13-8-4-5-9-14(13)20-17(15)18)21(12)10-6-3-7-11-24(2,22)23/h3-11H2,1-2H3,(H2,18,20) |
| InChIKey | ZKMNULSMTJUFLO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|