About 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline
2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline (PubChem CID 22320512) has the molecular formula C17H21N3S
and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline |
| PubChem CID | 22320512 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline |
| SMILES | CSCCCCCn1c(C)nc2cnc3ccccc3c21 |
| InChI | InChI=1S/C17H21N3S/c1-13-19-16-12-18-15-9-5-4-8-14(15)17(16)20(13)10-6-3-7-11-21-2/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3 |
| InChIKey | NVYVBLQKYZPECR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline?
The IUPAC name of 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline (CID 22320512) is 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline.
What is the SMILES notation for 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline?
The canonical SMILES for 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline is CSCCCCCn1c(C)nc2cnc3ccccc3c21.
What is the InChIKey of 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline?
The InChIKey is NVYVBLQKYZPECR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3S/c1-13-19-16-12-18-15-9-5-4-8-14(15)17(16)20(13)10-6-3-7-11-21-2/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3.
What are the key properties of 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline?
2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline has a molecular weight of 299.44 g/mol, XLogP of 4.43, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(5-methylsulfanylpentyl)imidazo[4,5-c]quinoline is sourced from PubChem (CID 22320512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).