About Citronellyl vinyl ether
Citronellyl vinyl ether (PubChem CID 22320909) has the molecular formula C12H22O
and a molecular weight of 182.30 g/mol. Its IUPAC name is 8-ethenoxy-2,6-dimethyloct-2-ene.
Molecular Properties
| Compound Name | Citronellyl vinyl ether |
| PubChem CID | 22320909 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.30 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 8-ethenoxy-2,6-dimethyloct-2-ene |
| SMILES | CC(CCC=C(C)C)CCOC=C |
| InChI | InChI=1S/C12H22O/c1-5-13-10-9-12(4)8-6-7-11(2)3/h5,7,12H,1,6,8-10H2,2-4H3 |
| InChIKey | PWCLCTUZQHYTKS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | 155 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Citronellyl vinyl ether with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Citronellyl vinyl ether?
The IUPAC name of Citronellyl vinyl ether (CID 22320909) is 8-ethenoxy-2,6-dimethyloct-2-ene.
What is the SMILES notation for Citronellyl vinyl ether?
The canonical SMILES for Citronellyl vinyl ether is CC(CCC=C(C)C)CCOC=C.
What is the InChIKey of Citronellyl vinyl ether?
The InChIKey is PWCLCTUZQHYTKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-5-13-10-9-12(4)8-6-7-11(2)3/h5,7,12H,1,6,8-10H2,2-4H3.
What are the key properties of Citronellyl vinyl ether?
Citronellyl vinyl ether has a molecular weight of 182.30 g/mol, XLogP of 4.50, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Citronellyl vinyl ether is sourced from PubChem (CID 22320909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).