About 2H-benzotriazole;hydrate
2H-benzotriazole;hydrate (PubChem CID 22320913) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 2H-benzotriazole;hydrate.
Molecular Properties
| Compound Name | 2H-benzotriazole;hydrate |
| PubChem CID | 22320913 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 2H-benzotriazole;hydrate |
| SMILES | O.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.H2O/c1-2-4-6-5(3-1)7-9-8-6;/h1-4H,(H,7,8,9);1H2 |
| InChIKey | JKSIXVZIFHKAPJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-benzotriazole;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;hydrate?
The IUPAC name of 2H-benzotriazole;hydrate (CID 22320913) is 2H-benzotriazole;hydrate.
What is the SMILES notation for 2H-benzotriazole;hydrate?
The canonical SMILES for 2H-benzotriazole;hydrate is O.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;hydrate?
The InChIKey is JKSIXVZIFHKAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.H2O/c1-2-4-6-5(3-1)7-9-8-6;/h1-4H,(H,7,8,9);1H2.
What are the key properties of 2H-benzotriazole;hydrate?
2H-benzotriazole;hydrate has a molecular weight of 137.14 g/mol, XLogP of 0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;hydrate is sourced from PubChem (CID 22320913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).