About 2-(2,4-diaminophenoxy)ethanol;hydrochloride
2-(2,4-diaminophenoxy)ethanol;hydrochloride (PubChem CID 22321000) has the molecular formula C8H13ClN2O2
and a molecular weight of 204.66 g/mol. Its IUPAC name is 2-(2,4-diaminophenoxy)ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,4-diaminophenoxy)ethanol;hydrochloride |
| PubChem CID | 22321000 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-(2,4-diaminophenoxy)ethanol;hydrochloride |
| SMILES | Cl.Nc1ccc(OCCO)c(N)c1 |
| InChI | InChI=1S/C8H12N2O2.ClH/c9-6-1-2-8(7(10)5-6)12-4-3-11;/h1-2,5,11H,3-4,9-10H2;1H |
| InChIKey | PBVFDMZFBPZIMC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-diaminophenoxy)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-diaminophenoxy)ethanol;hydrochloride?
The IUPAC name of 2-(2,4-diaminophenoxy)ethanol;hydrochloride (CID 22321000) is 2-(2,4-diaminophenoxy)ethanol;hydrochloride.
What is the SMILES notation for 2-(2,4-diaminophenoxy)ethanol;hydrochloride?
The canonical SMILES for 2-(2,4-diaminophenoxy)ethanol;hydrochloride is Cl.Nc1ccc(OCCO)c(N)c1.
What is the InChIKey of 2-(2,4-diaminophenoxy)ethanol;hydrochloride?
The InChIKey is PBVFDMZFBPZIMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.ClH/c9-6-1-2-8(7(10)5-6)12-4-3-11;/h1-2,5,11H,3-4,9-10H2;1H.
What are the key properties of 2-(2,4-diaminophenoxy)ethanol;hydrochloride?
2-(2,4-diaminophenoxy)ethanol;hydrochloride has a molecular weight of 204.66 g/mol, XLogP of 0.64, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-diaminophenoxy)ethanol;hydrochloride is sourced from PubChem (CID 22321000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).