About 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol
6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol (PubChem CID 22321033) has the molecular formula C6H4N4O5
and a molecular weight of 212.12 g/mol. Its IUPAC name is 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol |
| PubChem CID | 22321033 |
| Molecular Formula | C6H4N4O5 |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol |
| SMILES | [N-]=[N+]=C1C=C([N+](=O)[O-])C=C([N+](=O)[O-])C1O |
| InChI | InChI=1S/C6H4N4O5/c7-8-4-1-3(9(12)13)2-5(6(4)11)10(14)15/h1-2,6,11H |
| InChIKey | JEWJSSVZWIFYKN-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol (CID 22321033) is 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol is [N-]=[N+]=C1C=C([N+](=O)[O-])C=C([N+](=O)[O-])C1O.
What is the InChIKey of 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol?
The InChIKey is JEWJSSVZWIFYKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O5/c7-8-4-1-3(9(12)13)2-5(6(4)11)10(14)15/h1-2,6,11H.
What are the key properties of 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol?
6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol has a molecular weight of 212.12 g/mol, XLogP of -0.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diazo-2,4-dinitrocyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 22321033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).