C9H13N3O5 — CID 22321089
6-[(3,4,5-trihydroxyoxan-2-yl)amino]-1H-pyrimidin-2-one (PubChem CID 22321089) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is 6-[(3,4,5-trihydroxyoxan-2-yl)amino]-1H-pyrimidin-2-one.
| Compound Name | 6-[(3,4,5-trihydroxyoxan-2-yl)amino]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 22321089 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 6-[(3,4,5-trihydroxyoxan-2-yl)amino]-1H-pyrimidin-2-one |
| SMILES | O=c1nccc(NC2OCC(O)C(O)C2O)[nH]1 |
| InChI | InChI=1S/C9H13N3O5/c13-4-3-17-8(7(15)6(4)14)11-5-1-2-10-9(16)12-5/h1-2,4,6-8,13-15H,3H2,(H2,10,11,12,16) |
| InChIKey | SXZQHQYIXLMEMN-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |