About tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate
tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate (PubChem CID 22321828) has the molecular formula C20H33N5O3S
and a molecular weight of 423.58 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate |
| PubChem CID | 22321828 |
| Molecular Formula | C20H33N5O3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate |
| SMILES | CN1CCC(N2CCN(C(=O)CN(C(=O)OC(C)(C)C)c3nccs3)CC2)CC1 |
| InChI | InChI=1S/C20H33N5O3S/c1-20(2,3)28-19(27)25(18-21-7-14-29-18)15-17(26)24-12-10-23(11-13-24)16-5-8-22(4)9-6-16/h7,14,16H,5-6,8-13,15H2,1-4H3 |
| InChIKey | VPSMEULSZIJMRF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate?
The IUPAC name of tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate (CID 22321828) is tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate?
The canonical SMILES for tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate is CN1CCC(N2CCN(C(=O)CN(C(=O)OC(C)(C)C)c3nccs3)CC2)CC1.
What is the InChIKey of tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate?
The InChIKey is VPSMEULSZIJMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N5O3S/c1-20(2,3)28-19(27)25(18-21-7-14-29-18)15-17(26)24-12-10-23(11-13-24)16-5-8-22(4)9-6-16/h7,14,16H,5-6,8-13,15H2,1-4H3.
What are the key properties of tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate?
tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate has a molecular weight of 423.58 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-oxoethyl]-N-(1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 22321828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).