About ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate
ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate (PubChem CID 22322153) has the molecular formula C18H19FN4O4S
and a molecular weight of 406.44 g/mol. Its IUPAC name is ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate |
| PubChem CID | 22322153 |
| Molecular Formula | C18H19FN4O4S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(nc(C)n2C)c1N(C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN4O4S/c1-5-27-18(24)14-10-20-17-15(21-11(2)22(17)3)16(14)23(4)28(25,26)13-8-6-12(19)7-9-13/h6-10H,5H2,1-4H3 |
| InChIKey | LDLZYRHBPFQLLC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate?
The IUPAC name of ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate (CID 22322153) is ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate.
What is the SMILES notation for ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate?
The canonical SMILES for ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate is CCOC(=O)c1cnc2c(nc(C)n2C)c1N(C)S(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate?
The InChIKey is LDLZYRHBPFQLLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN4O4S/c1-5-27-18(24)14-10-20-17-15(21-11(2)22(17)3)16(14)23(4)28(25,26)13-8-6-12(19)7-9-13/h6-10H,5H2,1-4H3.
What are the key properties of ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate?
ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate has a molecular weight of 406.44 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[(4-fluorophenyl)sulfonyl-methylamino]-2,3-dimethylimidazo[4,5-b]pyridine-6-carboxylate is sourced from PubChem (CID 22322153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).