C20H26Cl2N4O3 — CID 22322257
N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-2,6-dimethoxypyrimidin-4-amine (PubChem CID 22322257) has the molecular formula C20H26Cl2N4O3 and a molecular weight of 441.36 g/mol. Its IUPAC name is N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-2,6-dimethoxypyrimidin-4-amine.
| Compound Name | N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-2,6-dimethoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 22322257 |
| Molecular Formula | C20H26Cl2N4O3 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-2,6-dimethoxypyrimidin-4-amine |
| SMILES | COc1cc(NCCCN2CCC(Oc3ccc(Cl)c(Cl)c3)CC2)nc(OC)n1 |
| InChI | InChI=1S/C20H26Cl2N4O3/c1-27-19-13-18(24-20(25-19)28-2)23-8-3-9-26-10-6-14(7-11-26)29-15-4-5-16(21)17(22)12-15/h4-5,12-14H,3,6-11H2,1-2H3,(H,23,24,25) |
| InChIKey | NOWGGYMOFSIVHA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|