About 3-ethyl-1-methyl-1,3-diazinan-4-one
3-ethyl-1-methyl-1,3-diazinan-4-one (PubChem CID 22323499) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 3-ethyl-1-methyl-1,3-diazinan-4-one |
| PubChem CID | 22323499 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3-ethyl-1-methyl-1,3-diazinan-4-one |
| SMILES | CCN1CN(C)CCC1=O |
| InChI | InChI=1S/C7H14N2O/c1-3-9-6-8(2)5-4-7(9)10/h3-6H2,1-2H3 |
| InChIKey | BTZPGWHAENVISN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1-methyl-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methyl-1,3-diazinan-4-one?
The IUPAC name of 3-ethyl-1-methyl-1,3-diazinan-4-one (CID 22323499) is 3-ethyl-1-methyl-1,3-diazinan-4-one.
What is the SMILES notation for 3-ethyl-1-methyl-1,3-diazinan-4-one?
The canonical SMILES for 3-ethyl-1-methyl-1,3-diazinan-4-one is CCN1CN(C)CCC1=O.
What is the InChIKey of 3-ethyl-1-methyl-1,3-diazinan-4-one?
The InChIKey is BTZPGWHAENVISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-3-9-6-8(2)5-4-7(9)10/h3-6H2,1-2H3.
What are the key properties of 3-ethyl-1-methyl-1,3-diazinan-4-one?
3-ethyl-1-methyl-1,3-diazinan-4-one has a molecular weight of 142.20 g/mol, XLogP of 0.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-1,3-diazinan-4-one is sourced from PubChem (CID 22323499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).