About 7-ethenyl-2,3-dihydrothiochromen-4-one
7-ethenyl-2,3-dihydrothiochromen-4-one (PubChem CID 22323788) has the molecular formula C11H10OS
and a molecular weight of 190.27 g/mol. Its IUPAC name is 7-ethenyl-2,3-dihydrothiochromen-4-one.
Molecular Properties
| Compound Name | 7-ethenyl-2,3-dihydrothiochromen-4-one |
| PubChem CID | 22323788 |
| Molecular Formula | C11H10OS |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 7-ethenyl-2,3-dihydrothiochromen-4-one |
| SMILES | C=Cc1ccc2c(c1)SCCC2=O |
| InChI | InChI=1S/C11H10OS/c1-2-8-3-4-9-10(12)5-6-13-11(9)7-8/h2-4,7H,1,5-6H2 |
| InChIKey | SUCINMASSQJTNH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethenyl-2,3-dihydrothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethenyl-2,3-dihydrothiochromen-4-one?
The IUPAC name of 7-ethenyl-2,3-dihydrothiochromen-4-one (CID 22323788) is 7-ethenyl-2,3-dihydrothiochromen-4-one.
What is the SMILES notation for 7-ethenyl-2,3-dihydrothiochromen-4-one?
The canonical SMILES for 7-ethenyl-2,3-dihydrothiochromen-4-one is C=Cc1ccc2c(c1)SCCC2=O.
What is the InChIKey of 7-ethenyl-2,3-dihydrothiochromen-4-one?
The InChIKey is SUCINMASSQJTNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10OS/c1-2-8-3-4-9-10(12)5-6-13-11(9)7-8/h2-4,7H,1,5-6H2.
What are the key properties of 7-ethenyl-2,3-dihydrothiochromen-4-one?
7-ethenyl-2,3-dihydrothiochromen-4-one has a molecular weight of 190.27 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenyl-2,3-dihydrothiochromen-4-one is sourced from PubChem (CID 22323788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).