About 7H-purin-6-amine;7H-purine
7H-purin-6-amine;7H-purine (PubChem CID 22323795) has the molecular formula C10H9N9
and a molecular weight of 255.25 g/mol. Its IUPAC name is 7H-purin-6-amine;7H-purine.
Molecular Properties
| Compound Name | 7H-purin-6-amine;7H-purine |
| PubChem CID | 22323795 |
| Molecular Formula | C10H9N9 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 7H-purin-6-amine;7H-purine |
| SMILES | Nc1ncnc2nc[nH]c12.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H5N5.C5H4N4/c6-4-3-5(9-1-7-3)10-2-8-4;1-4-5(8-2-6-1)9-3-7-4/h1-2H,(H3,6,7,8,9,10);1-3H,(H,6,7,8,9) |
| InChIKey | AXXVSCRPHPIDIW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7H-purin-6-amine;7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purin-6-amine;7H-purine?
The IUPAC name of 7H-purin-6-amine;7H-purine (CID 22323795) is 7H-purin-6-amine;7H-purine.
What is the SMILES notation for 7H-purin-6-amine;7H-purine?
The canonical SMILES for 7H-purin-6-amine;7H-purine is Nc1ncnc2nc[nH]c12.c1ncc2[nH]cnc2n1.
What is the InChIKey of 7H-purin-6-amine;7H-purine?
The InChIKey is AXXVSCRPHPIDIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5.C5H4N4/c6-4-3-5(9-1-7-3)10-2-8-4;1-4-5(8-2-6-1)9-3-7-4/h1-2H,(H3,6,7,8,9,10);1-3H,(H,6,7,8,9).
What are the key properties of 7H-purin-6-amine;7H-purine?
7H-purin-6-amine;7H-purine has a molecular weight of 255.25 g/mol, XLogP of 0.29, 0 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purin-6-amine;7H-purine is sourced from PubChem (CID 22323795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).