C19H21N3O4S — CID 22323982
3-cyclohexyl-7-(2-nitrophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 22323982) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-cyclohexyl-7-(2-nitrophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-cyclohexyl-7-(2-nitrophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 22323982 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-cyclohexyl-7-(2-nitrophenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc2c(c1)S(=O)(=O)NC(C1CCCCC1)N2 |
| InChI | InChI=1S/C19H21N3O4S/c23-22(24)17-9-5-4-8-15(17)14-10-11-16-18(12-14)27(25,26)21-19(20-16)13-6-2-1-3-7-13/h4-5,8-13,19-21H,1-3,6-7H2 |
| InChIKey | IOTOZEFUYSZNDX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|