About 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one
2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one (PubChem CID 22324320) has the molecular formula C19H25Cl2N3O
and a molecular weight of 382.34 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one |
| PubChem CID | 22324320 |
| Molecular Formula | C19H25Cl2N3O |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one |
| SMILES | CCCN(CCC)c1c(C)nc(-c2ccc(Cl)cc2Cl)n(CC)c1=O |
| InChI | InChI=1S/C19H25Cl2N3O/c1-5-10-23(11-6-2)17-13(4)22-18(24(7-3)19(17)25)15-9-8-14(20)12-16(15)21/h8-9,12H,5-7,10-11H2,1-4H3 |
| InChIKey | CZZWROMXVJEUPV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one?
The IUPAC name of 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one (CID 22324320) is 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one.
What is the SMILES notation for 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one?
The canonical SMILES for 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one is CCCN(CCC)c1c(C)nc(-c2ccc(Cl)cc2Cl)n(CC)c1=O.
What is the InChIKey of 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one?
The InChIKey is CZZWROMXVJEUPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25Cl2N3O/c1-5-10-23(11-6-2)17-13(4)22-18(24(7-3)19(17)25)15-9-8-14(20)12-16(15)21/h8-9,12H,5-7,10-11H2,1-4H3.
What are the key properties of 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one?
2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one has a molecular weight of 382.34 g/mol, XLogP of 5.17, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenyl)-5-(dipropylamino)-3-ethyl-6-methylpyrimidin-4-one is sourced from PubChem (CID 22324320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).