C9H9Br2NO — CID 22324430
6,8-dibromo-3,4a,5,6-tetrahydro-2H-quinolin-4-one (PubChem CID 22324430) has the molecular formula C9H9Br2NO and a molecular weight of 306.99 g/mol. Its IUPAC name is 6,8-dibromo-3,4a,5,6-tetrahydro-2H-quinolin-4-one.
| Compound Name | 6,8-dibromo-3,4a,5,6-tetrahydro-2H-quinolin-4-one |
|---|---|
| PubChem CID | 22324430 |
| Molecular Formula | C9H9Br2NO |
| Molecular Weight | 306.99 g/mol |
| Exact Mass | 304.91 |
| IUPAC Name | 6,8-dibromo-3,4a,5,6-tetrahydro-2H-quinolin-4-one |
| SMILES | O=C1CCN=C2C(Br)=CC(Br)CC12 |
| InChI | InChI=1S/C9H9Br2NO/c10-5-3-6-8(13)1-2-12-9(6)7(11)4-5/h4-6H,1-3H2 |
| InChIKey | LYEOFAMMIAFWCX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.99 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|