About 10aH-pyrano[3,2-h][1,4]benzodioxine
10aH-pyrano[3,2-h][1,4]benzodioxine (PubChem CID 22324460) has the molecular formula C11H8O3
and a molecular weight of 188.18 g/mol. Its IUPAC name is 10aH-pyrano[3,2-h][1,4]benzodioxine.
Molecular Properties
| Compound Name | 10aH-pyrano[3,2-h][1,4]benzodioxine |
| PubChem CID | 22324460 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 10aH-pyrano[3,2-h][1,4]benzodioxine |
| SMILES | C1=COC2C(=C1)C=CC1=C2OC=CO1 |
| InChI | InChI=1S/C11H8O3/c1-2-8-3-4-9-11(10(8)13-5-1)14-7-6-12-9/h1-7,10H |
| InChIKey | IBJALDCDCSYVEJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10aH-pyrano[3,2-h][1,4]benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10aH-pyrano[3,2-h][1,4]benzodioxine?
The IUPAC name of 10aH-pyrano[3,2-h][1,4]benzodioxine (CID 22324460) is 10aH-pyrano[3,2-h][1,4]benzodioxine.
What is the SMILES notation for 10aH-pyrano[3,2-h][1,4]benzodioxine?
The canonical SMILES for 10aH-pyrano[3,2-h][1,4]benzodioxine is C1=COC2C(=C1)C=CC1=C2OC=CO1.
What is the InChIKey of 10aH-pyrano[3,2-h][1,4]benzodioxine?
The InChIKey is IBJALDCDCSYVEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O3/c1-2-8-3-4-9-11(10(8)13-5-1)14-7-6-12-9/h1-7,10H.
What are the key properties of 10aH-pyrano[3,2-h][1,4]benzodioxine?
10aH-pyrano[3,2-h][1,4]benzodioxine has a molecular weight of 188.18 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10aH-pyrano[3,2-h][1,4]benzodioxine is sourced from PubChem (CID 22324460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).