About 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine
10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine (PubChem CID 22324461) has the molecular formula C12H11NO3
and a molecular weight of 217.22 g/mol. Its IUPAC name is 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine.
Molecular Properties
| Compound Name | 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine |
| PubChem CID | 22324461 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine |
| SMILES | NCC1=COC2=C(C=CC3=CC=COC32)O1 |
| InChI | InChI=1S/C12H11NO3/c13-6-9-7-15-12-10(16-9)4-3-8-2-1-5-14-11(8)12/h1-5,7,11H,6,13H2 |
| InChIKey | OWISKFYABNFEBT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine?
The IUPAC name of 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine (CID 22324461) is 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine.
What is the SMILES notation for 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine?
The canonical SMILES for 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine is NCC1=COC2=C(C=CC3=CC=COC32)O1.
What is the InChIKey of 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine?
The InChIKey is OWISKFYABNFEBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3/c13-6-9-7-15-12-10(16-9)4-3-8-2-1-5-14-11(8)12/h1-5,7,11H,6,13H2.
What are the key properties of 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine?
10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine has a molecular weight of 217.22 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10aH-pyrano[3,2-h][1,4]benzodioxin-3-ylmethanamine is sourced from PubChem (CID 22324461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).