C32H31N3O5S — CID 22324949
4-[[2-(2-imidazol-1-yl-1-phenylethoxy)-5-oxo-7,8-dihydro-6H-naphthalen-1-yl]methylsulfonyl]-N-prop-2-enylbenzamide (PubChem CID 22324949) has the molecular formula C32H31N3O5S and a molecular weight of 569.68 g/mol. Its IUPAC name is 4-[[2-(2-imidazol-1-yl-1-phenylethoxy)-5-oxo-7,8-dihydro-6H-naphthalen-1-yl]methylsulfonyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-[[2-(2-imidazol-1-yl-1-phenylethoxy)-5-oxo-7,8-dihydro-6H-naphthalen-1-yl]methylsulfonyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 22324949 |
| Molecular Formula | C32H31N3O5S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 4-[[2-(2-imidazol-1-yl-1-phenylethoxy)-5-oxo-7,8-dihydro-6H-naphthalen-1-yl]methylsulfonyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(S(=O)(=O)Cc2c(OC(Cn3ccnc3)c3ccccc3)ccc3c2CCCC3=O)cc1 |
| InChI | InChI=1S/C32H31N3O5S/c1-2-17-34-32(37)24-11-13-25(14-12-24)41(38,39)21-28-26-9-6-10-29(36)27(26)15-16-30(28)40-31(20-35-19-18-33-22-35)23-7-4-3-5-8-23/h2-5,7-8,11-16,18-19,22,31H,1,6,9-10,17,20-21H2,(H,34,37) |
| InChIKey | DSWPHTCWTDDEHU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|