About 4-(4-bromophenoxy)butyl thiocyanate
4-(4-bromophenoxy)butyl thiocyanate (PubChem CID 2232532) has the molecular formula C11H12BrNOS
and a molecular weight of 286.19 g/mol. Its IUPAC name is 4-(4-bromophenoxy)butyl thiocyanate.
Molecular Properties
| Compound Name | 4-(4-bromophenoxy)butyl thiocyanate |
| PubChem CID | 2232532 |
| Molecular Formula | C11H12BrNOS |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 4-(4-bromophenoxy)butyl thiocyanate |
| SMILES | N#CSCCCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrNOS/c12-10-3-5-11(6-4-10)14-7-1-2-8-15-9-13/h3-6H,1-2,7-8H2 |
| InChIKey | QBGQCUWLGKNVQI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenoxy)butyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenoxy)butyl thiocyanate?
The IUPAC name of 4-(4-bromophenoxy)butyl thiocyanate (CID 2232532) is 4-(4-bromophenoxy)butyl thiocyanate.
What is the SMILES notation for 4-(4-bromophenoxy)butyl thiocyanate?
The canonical SMILES for 4-(4-bromophenoxy)butyl thiocyanate is N#CSCCCCOc1ccc(Br)cc1.
What is the InChIKey of 4-(4-bromophenoxy)butyl thiocyanate?
The InChIKey is QBGQCUWLGKNVQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrNOS/c12-10-3-5-11(6-4-10)14-7-1-2-8-15-9-13/h3-6H,1-2,7-8H2.
What are the key properties of 4-(4-bromophenoxy)butyl thiocyanate?
4-(4-bromophenoxy)butyl thiocyanate has a molecular weight of 286.19 g/mol, XLogP of 3.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenoxy)butyl thiocyanate is sourced from PubChem (CID 2232532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).