C4H9F3 — CID 22325848
methane;1,1,2-trifluoropropane (PubChem CID 22325848) has the molecular formula C4H9F3 and a molecular weight of 114.11 g/mol. Its IUPAC name is methane;1,1,2-trifluoropropane.
| Compound Name | methane;1,1,2-trifluoropropane |
|---|---|
| PubChem CID | 22325848 |
| Molecular Formula | C4H9F3 |
| Molecular Weight | 114.11 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | methane;1,1,2-trifluoropropane |
| SMILES | C.CC(F)C(F)F |
| InChI | InChI=1S/C3H5F3.CH4/c1-2(4)3(5)6;/h2-3H,1H3;1H4 |
| InChIKey | IQJFWAMWPDAXKY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.11 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |