About 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride
2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride (PubChem CID 22325939) has the molecular formula C10H23ClN2O
and a molecular weight of 222.76 g/mol. Its IUPAC name is 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride.
Molecular Properties
| Compound Name | 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride |
| PubChem CID | 22325939 |
| Molecular Formula | C10H23ClN2O |
| Molecular Weight | 222.76 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride |
| SMILES | C=C(C)C(N)=O.CCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C6H16N.C4H7NO.ClH/c1-5-6-7(2,3)4;1-3(2)4(5)6;/h5-6H2,1-4H3;1H2,2H3,(H2,5,6);1H/q+1;;/p-1 |
| InChIKey | WEAQXVDSAUMZHI-UHFFFAOYSA-M |
| XLogP | -1.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.76 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride?
The IUPAC name of 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride (CID 22325939) is 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride.
What is the SMILES notation for 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride?
The canonical SMILES for 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride is C=C(C)C(N)=O.CCC[N+](C)(C)C.[Cl-].
What is the InChIKey of 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride?
The InChIKey is WEAQXVDSAUMZHI-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H16N.C4H7NO.ClH/c1-5-6-7(2,3)4;1-3(2)4(5)6;/h5-6H2,1-4H3;1H2,2H3,(H2,5,6);1H/q+1;;/p-1.
What are the key properties of 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride?
2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride has a molecular weight of 222.76 g/mol, XLogP of -1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enamide;trimethyl(propyl)azanium;chloride is sourced from PubChem (CID 22325939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).