C14H24O5 — CID 22325969
2,3-dihydroxypropanoyl undec-10-enoate (PubChem CID 22325969) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2,3-dihydroxypropanoyl undec-10-enoate.
| Compound Name | 2,3-dihydroxypropanoyl undec-10-enoate |
|---|---|
| PubChem CID | 22325969 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2,3-dihydroxypropanoyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OC(=O)C(O)CO |
| InChI | InChI=1S/C14H24O5/c1-2-3-4-5-6-7-8-9-10-13(17)19-14(18)12(16)11-15/h2,12,15-16H,1,3-11H2 |
| InChIKey | DOZYUJWXYJDSBB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|