About 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide
3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide (PubChem CID 22325991) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide |
| PubChem CID | 22325991 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC=C(CCN)C1 |
| InChI | InChI=1S/C7H14N4/c8-3-1-6-2-4-11(5-6)7(9)10/h2H,1,3-5,8H2,(H3,9,10) |
| InChIKey | YDRVFCVPWICTOV-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide?
The IUPAC name of 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide (CID 22325991) is 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide.
What is the SMILES notation for 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide?
The canonical SMILES for 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide is [H]/N=C(\N)N1CC=C(CCN)C1.
What is the InChIKey of 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide?
The InChIKey is YDRVFCVPWICTOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c8-3-1-6-2-4-11(5-6)7(9)10/h2H,1,3-5,8H2,(H3,9,10).
What are the key properties of 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide?
3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide has a molecular weight of 154.22 g/mol, XLogP of -0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide is sourced from PubChem (CID 22325991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).