About 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline
4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline (PubChem CID 22326034) has the molecular formula C26H24N2
and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline |
| PubChem CID | 22326034 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline |
| SMILES | Cc1cccc(-c2c(N)ccc(-c3ccc(N)cc3)c2-c2cccc(C)c2)c1 |
| InChI | InChI=1S/C26H24N2/c1-17-5-3-7-20(15-17)25-23(19-9-11-22(27)12-10-19)13-14-24(28)26(25)21-8-4-6-18(2)16-21/h3-16H,27-28H2,1-2H3 |
| InChIKey | GXHFAFFBRFVGLX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline?
The IUPAC name of 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline (CID 22326034) is 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline.
What is the SMILES notation for 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline?
The canonical SMILES for 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline is Cc1cccc(-c2c(N)ccc(-c3ccc(N)cc3)c2-c2cccc(C)c2)c1.
What is the InChIKey of 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline?
The InChIKey is GXHFAFFBRFVGLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2/c1-17-5-3-7-20(15-17)25-23(19-9-11-22(27)12-10-19)13-14-24(28)26(25)21-8-4-6-18(2)16-21/h3-16H,27-28H2,1-2H3.
What are the key properties of 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline?
4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline has a molecular weight of 364.49 g/mol, XLogP of 6.47, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)aniline is sourced from PubChem (CID 22326034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).