C16H32O — CID 22326187
1-(2,2,3,6-tetramethylcyclohexyl)hexan-3-ol (PubChem CID 22326187) has the molecular formula C16H32O and a molecular weight of 240.43 g/mol. Its IUPAC name is 1-(2,2,3,6-tetramethylcyclohexyl)hexan-3-ol.
| Compound Name | 1-(2,2,3,6-tetramethylcyclohexyl)hexan-3-ol |
|---|---|
| PubChem CID | 22326187 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 1-(2,2,3,6-tetramethylcyclohexyl)hexan-3-ol |
| SMILES | CCCC(O)CCC1C(C)CCC(C)C1(C)C |
| InChI | InChI=1S/C16H32O/c1-6-7-14(17)10-11-15-12(2)8-9-13(3)16(15,4)5/h12-15,17H,6-11H2,1-5H3 |
| InChIKey | ZXEXKFFXTYZXJT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |