C14H10F3N5O — CID 22326794
5-[6-(trifluoromethoxy)quinolin-3-yl]pyrimidine-2,4-diamine (PubChem CID 22326794) has the molecular formula C14H10F3N5O and a molecular weight of 321.26 g/mol. Its IUPAC name is 5-[6-(trifluoromethoxy)quinolin-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 5-[6-(trifluoromethoxy)quinolin-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22326794 |
| Molecular Formula | C14H10F3N5O |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-[6-(trifluoromethoxy)quinolin-3-yl]pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2cnc3ccc(OC(F)(F)F)cc3c2)c(N)n1 |
| InChI | InChI=1S/C14H10F3N5O/c15-14(16,17)23-9-1-2-11-7(4-9)3-8(5-20-11)10-6-21-13(19)22-12(10)18/h1-6H,(H4,18,19,21,22) |
| InChIKey | KPGDHWKARGXWEC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |