C26H21N2O2S+ — CID 22326944
2-[[4-(1-benzothiophen-7-yl)pyridin-1-ium-1-yl]methyl]-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinoline (PubChem CID 22326944) has the molecular formula C26H21N2O2S+ and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[[4-(1-benzothiophen-7-yl)pyridin-1-ium-1-yl]methyl]-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinoline.
| Compound Name | 2-[[4-(1-benzothiophen-7-yl)pyridin-1-ium-1-yl]methyl]-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinoline |
|---|---|
| PubChem CID | 22326944 |
| Molecular Formula | C26H21N2O2S+ |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-[[4-(1-benzothiophen-7-yl)pyridin-1-ium-1-yl]methyl]-8-methyl-2,3-dihydro-[1,4]dioxino[2,3-f]quinoline |
| SMILES | Cc1ccc2c3c(ccc2n1)OCC(C[n+]1ccc(-c2cccc4ccsc24)cc1)O3 |
| InChI | InChI=1S/C26H21N2O2S/c1-17-5-6-22-23(27-17)7-8-24-25(22)30-20(16-29-24)15-28-12-9-18(10-13-28)21-4-2-3-19-11-14-31-26(19)21/h2-14,20H,15-16H2,1H3/q+1 |
| InChIKey | AAUPGGPBKPLWPU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|