C26H26F7NS — CID 22327643
N-(1-naphthalen-1-ylethyl)-7-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylheptan-1-amine (PubChem CID 22327643) has the molecular formula C26H26F7NS and a molecular weight of 517.55 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)-7-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylheptan-1-amine.
| Compound Name | N-(1-naphthalen-1-ylethyl)-7-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylheptan-1-amine |
|---|---|
| PubChem CID | 22327643 |
| Molecular Formula | C26H26F7NS |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)-7-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylheptan-1-amine |
| SMILES | CC(NCCCCCCCSc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H26F7NS/c1-16(18-13-9-11-17-10-5-6-12-19(17)18)34-14-7-3-2-4-8-15-35-25-23(29)21(27)20(26(31,32)33)22(28)24(25)30/h5-6,9-13,16,34H,2-4,7-8,14-15H2,1H3 |
| InChIKey | MAOJLIIVRVDDET-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|