C23H20F7NS — CID 22327661
N-(1-naphthalen-1-ylethyl)-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylbutan-1-amine (PubChem CID 22327661) has the molecular formula C23H20F7NS and a molecular weight of 475.47 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylbutan-1-amine.
| Compound Name | N-(1-naphthalen-1-ylethyl)-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylbutan-1-amine |
|---|---|
| PubChem CID | 22327661 |
| Molecular Formula | C23H20F7NS |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]sulfanylbutan-1-amine |
| SMILES | CC(NCCCCSc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H20F7NS/c1-13(15-10-6-8-14-7-2-3-9-16(14)15)31-11-4-5-12-32-22-20(26)18(24)17(23(28,29)30)19(25)21(22)27/h2-3,6-10,13,31H,4-5,11-12H2,1H3 |
| InChIKey | FSPXGLRFXPKQGT-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|