C17H18Cl2FNOS — CID 22327662
N-[2-(2,5-dichlorophenyl)sulfanylethyl]-1-(3-fluoro-4-methoxyphenyl)ethanamine (PubChem CID 22327662) has the molecular formula C17H18Cl2FNOS and a molecular weight of 374.31 g/mol. Its IUPAC name is N-[2-(2,5-dichlorophenyl)sulfanylethyl]-1-(3-fluoro-4-methoxyphenyl)ethanamine.
| Compound Name | N-[2-(2,5-dichlorophenyl)sulfanylethyl]-1-(3-fluoro-4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 22327662 |
| Molecular Formula | C17H18Cl2FNOS |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | N-[2-(2,5-dichlorophenyl)sulfanylethyl]-1-(3-fluoro-4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(C(C)NCCSc2cc(Cl)ccc2Cl)cc1F |
| InChI | InChI=1S/C17H18Cl2FNOS/c1-11(12-3-6-16(22-2)15(20)9-12)21-7-8-23-17-10-13(18)4-5-14(17)19/h3-6,9-11,21H,7-8H2,1-2H3 |
| InChIKey | SEOGSDPKYUUFNU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|