About 3,5-ditert-butyl-N,N-dimethylaniline
3,5-ditert-butyl-N,N-dimethylaniline (PubChem CID 22327738) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is 3,5-ditert-butyl-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-N,N-dimethylaniline |
| PubChem CID | 22327738 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 3,5-ditert-butyl-N,N-dimethylaniline |
| SMILES | CN(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H27N/c1-15(2,3)12-9-13(16(4,5)6)11-14(10-12)17(7)8/h9-11H,1-8H3 |
| InChIKey | FIJRQSPKMCQFJU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-ditert-butyl-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-N,N-dimethylaniline?
The IUPAC name of 3,5-ditert-butyl-N,N-dimethylaniline (CID 22327738) is 3,5-ditert-butyl-N,N-dimethylaniline.
What is the SMILES notation for 3,5-ditert-butyl-N,N-dimethylaniline?
The canonical SMILES for 3,5-ditert-butyl-N,N-dimethylaniline is CN(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1.
What is the InChIKey of 3,5-ditert-butyl-N,N-dimethylaniline?
The InChIKey is FIJRQSPKMCQFJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N/c1-15(2,3)12-9-13(16(4,5)6)11-14(10-12)17(7)8/h9-11H,1-8H3.
What are the key properties of 3,5-ditert-butyl-N,N-dimethylaniline?
3,5-ditert-butyl-N,N-dimethylaniline has a molecular weight of 233.40 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-N,N-dimethylaniline is sourced from PubChem (CID 22327738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).