About bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol
bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol (PubChem CID 22327927) has the molecular formula C14H10O
and a molecular weight of 194.23 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol |
| PubChem CID | 22327927 |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol |
| SMILES | C#Cc1ccccc1O.c1cc2ccc1-2 |
| InChI | InChI=1S/C8H6O.C6H4/c1-2-7-5-3-4-6-8(7)9;1-2-6-4-3-5(1)6/h1,3-6,9H;1-4H |
| InChIKey | HROCBLAAMWNDAD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol (CID 22327927) is bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol is C#Cc1ccccc1O.c1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol?
The InChIKey is HROCBLAAMWNDAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C6H4/c1-2-7-5-3-4-6-8(7)9;1-2-6-4-3-5(1)6/h1,3-6,9H;1-4H.
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol?
bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol has a molecular weight of 194.23 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynylphenol is sourced from PubChem (CID 22327927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).