About N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide
N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide (PubChem CID 2232815) has the molecular formula C18H9BrCl2N2O2S
and a molecular weight of 468.16 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide |
| PubChem CID | 2232815 |
| Molecular Formula | C18H9BrCl2N2O2S |
| Molecular Weight | 468.16 g/mol |
| Exact Mass | 465.89 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1-c1nc2ccccc2s1)c1ccc(Br)o1 |
| InChI | InChI=1S/C18H9BrCl2N2O2S/c19-15-6-5-13(25-15)17(24)23-16-10(7-9(20)8-11(16)21)18-22-12-3-1-2-4-14(12)26-18/h1-8H,(H,23,24) |
| InChIKey | CCKFIERXSFPBOC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.16 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide?
The IUPAC name of N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide (CID 2232815) is N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide.
What is the SMILES notation for N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide?
The canonical SMILES for N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide is O=C(Nc1c(Cl)cc(Cl)cc1-c1nc2ccccc2s1)c1ccc(Br)o1.
What is the InChIKey of N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide?
The InChIKey is CCKFIERXSFPBOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9BrCl2N2O2S/c19-15-6-5-13(25-15)17(24)23-16-10(7-9(20)8-11(16)21)18-22-12-3-1-2-4-14(12)26-18/h1-8H,(H,23,24).
What are the key properties of N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide?
N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide has a molecular weight of 468.16 g/mol, XLogP of 6.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-5-bromofuran-2-carboxamide is sourced from PubChem (CID 2232815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).