About 6-(2,5-dioxopyrrol-1-yl)hexanal
6-(2,5-dioxopyrrol-1-yl)hexanal (PubChem CID 22328222) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexanal.
Molecular Properties
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexanal |
| PubChem CID | 22328222 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanal |
| SMILES | O=CCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H13NO3/c12-8-4-2-1-3-7-11-9(13)5-6-10(11)14/h5-6,8H,1-4,7H2 |
| InChIKey | ZWIGHFZUSGHZEZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,5-dioxopyrrol-1-yl)hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dioxopyrrol-1-yl)hexanal?
The IUPAC name of 6-(2,5-dioxopyrrol-1-yl)hexanal (CID 22328222) is 6-(2,5-dioxopyrrol-1-yl)hexanal.
What is the SMILES notation for 6-(2,5-dioxopyrrol-1-yl)hexanal?
The canonical SMILES for 6-(2,5-dioxopyrrol-1-yl)hexanal is O=CCCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 6-(2,5-dioxopyrrol-1-yl)hexanal?
The InChIKey is ZWIGHFZUSGHZEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c12-8-4-2-1-3-7-11-9(13)5-6-10(11)14/h5-6,8H,1-4,7H2.
What are the key properties of 6-(2,5-dioxopyrrol-1-yl)hexanal?
6-(2,5-dioxopyrrol-1-yl)hexanal has a molecular weight of 195.22 g/mol, XLogP of 0.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dioxopyrrol-1-yl)hexanal is sourced from PubChem (CID 22328222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).