About bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid)
bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid) (PubChem CID 22328243) has the molecular formula C43H82O6
and a molecular weight of 695.12 g/mol. Its IUPAC name is bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid).
Molecular Properties
| Compound Name | bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid) |
| PubChem CID | 22328243 |
| Molecular Formula | C43H82O6 |
| Molecular Weight | 695.12 g/mol |
| Exact Mass | 694.61 |
| IUPAC Name | bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid) |
| SMILES | C1CCCCCCCCCC1.C1CCCCCCCCCC1.C=C(C)C(=O)O.C=C(C)C(=O)O.OCC1(CO)CCCCCCCCCC1 |
| InChI | InChI=1S/C13H26O2.2C11H22.2C4H6O2/c14-11-13(12-15)9-7-5-3-1-2-4-6-8-10-13;2*1-2-4-6-8-10-11-9-7-5-3-1;2*1-3(2)4(5)6/h14-15H,1-12H2;2*1-11H2;2*1H2,2H3,(H,5,6) |
| InChIKey | NVJKWMSBHYOWAZ-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 695.12 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid)?
The IUPAC name of bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid) (CID 22328243) is bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid).
What is the SMILES notation for bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid)?
The canonical SMILES for bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid) is C1CCCCCCCCCC1.C1CCCCCCCCCC1.C=C(C)C(=O)O.C=C(C)C(=O)O.OCC1(CO)CCCCCCCCCC1.
What is the InChIKey of bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid)?
The InChIKey is NVJKWMSBHYOWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2.2C11H22.2C4H6O2/c14-11-13(12-15)9-7-5-3-1-2-4-6-8-10-13;2*1-2-4-6-8-10-11-9-7-5-3-1;2*1-3(2)4(5)6/h14-15H,1-12H2;2*1-11H2;2*1H2,2H3,(H,5,6).
What are the key properties of bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid)?
bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid) has a molecular weight of 695.12 g/mol, XLogP of 12.75, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cycloundecane);[1-(hydroxymethyl)cycloundecyl]methanol;bis(2-methylprop-2-enoic acid) is sourced from PubChem (CID 22328243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).