About N-fluoroacetamide
N-fluoroacetamide (PubChem CID 22328421) has the molecular formula C2H4FNO
and a molecular weight of 77.06 g/mol. Its IUPAC name is N-fluoroacetamide.
Molecular Properties
| Compound Name | N-fluoroacetamide |
| PubChem CID | 22328421 |
| Molecular Formula | C2H4FNO |
| Molecular Weight | 77.06 g/mol |
| Exact Mass | 77.03 |
| IUPAC Name | N-fluoroacetamide |
| SMILES | CC(=O)NF |
| InChI | InChI=1S/C2H4FNO/c1-2(5)4-3/h1H3,(H,4,5) |
| InChIKey | QGNBDSPDXGLEJP-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 77.06 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-fluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluoroacetamide?
The IUPAC name of N-fluoroacetamide (CID 22328421) is N-fluoroacetamide.
What is the SMILES notation for N-fluoroacetamide?
The canonical SMILES for N-fluoroacetamide is CC(=O)NF.
What is the InChIKey of N-fluoroacetamide?
The InChIKey is QGNBDSPDXGLEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4FNO/c1-2(5)4-3/h1H3,(H,4,5).
What are the key properties of N-fluoroacetamide?
N-fluoroacetamide has a molecular weight of 77.06 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluoroacetamide is sourced from PubChem (CID 22328421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).