2-(cyclohexa-2,4-dien-1-ylamino)acetic acid

C8H11NO2 — CID 22328589

IUPAC2-(cyclohexa-2,4-dien-1-ylamino)acetic acid
SMILESO=C(O)CNC1C=CC=CC1
InChIInChI=1S/C8H11NO2/c10-8(11)6-9-7-4-2-1-3-5-7/h1-4,7,9H,5-6H2,(H,10,11)
InChIKeySKYHUMUZNRYJMS-UHFFFAOYSA-N
MW153.18 g/mol
LogP0.55
Rot. Bonds3

About 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid

2-(cyclohexa-2,4-dien-1-ylamino)acetic acid (PubChem CID 22328589) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid.

Molecular Properties

Compound Name2-(cyclohexa-2,4-dien-1-ylamino)acetic acid
PubChem CID22328589
Molecular FormulaC8H11NO2
Molecular Weight153.18 g/mol
Exact Mass153.08
IUPAC Name2-(cyclohexa-2,4-dien-1-ylamino)acetic acid
SMILESO=C(O)CNC1C=CC=CC1
InChIInChI=1S/C8H11NO2/c10-8(11)6-9-7-4-2-1-3-5-7/h1-4,7,9H,5-6H2,(H,10,11)
InChIKeySKYHUMUZNRYJMS-UHFFFAOYSA-N
XLogP0.55
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.18
LogP ≤ 50.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid?
The IUPAC name of 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid (CID 22328589) is 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid.
What is the SMILES notation for 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid?
The canonical SMILES for 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid is O=C(O)CNC1C=CC=CC1.
What is the InChIKey of 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid?
The InChIKey is SKYHUMUZNRYJMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c10-8(11)6-9-7-4-2-1-3-5-7/h1-4,7,9H,5-6H2,(H,10,11).
What are the key properties of 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid?
2-(cyclohexa-2,4-dien-1-ylamino)acetic acid has a molecular weight of 153.18 g/mol, XLogP of 0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexa-2,4-dien-1-ylamino)acetic acid is sourced from PubChem (CID 22328589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).