C14H13ClFN3 — CID 22329344
8-chloro-6-(2-fluorophenyl)-1-methyl-3,5-dihydroimidazo[1,5-a][1,4]diazepine (PubChem CID 22329344) has the molecular formula C14H13ClFN3 and a molecular weight of 277.73 g/mol. Its IUPAC name is 8-chloro-6-(2-fluorophenyl)-1-methyl-3,5-dihydroimidazo[1,5-a][1,4]diazepine.
| Compound Name | 8-chloro-6-(2-fluorophenyl)-1-methyl-3,5-dihydroimidazo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 22329344 |
| Molecular Formula | C14H13ClFN3 |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 8-chloro-6-(2-fluorophenyl)-1-methyl-3,5-dihydroimidazo[1,5-a][1,4]diazepine |
| SMILES | CC1=NCN2CC(c3ccccc3F)=CN(Cl)C=C12 |
| InChI | InChI=1S/C14H13ClFN3/c1-10-14-8-19(15)7-11(6-18(14)9-17-10)12-4-2-3-5-13(12)16/h2-5,7-8H,6,9H2,1H3 |
| InChIKey | WNTLOXMBURINTC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|